Amino Acid Reference Chart
Amino acids are the building blocks that make up all proteins, polypeptides and peptides. Each amino acid consists of a central carbon, known as the α-carbon, to which an amino group (-NH2), an acidic carboxyl group (-COOH) and an organic side chain (-R group) are bound. The R group, which differs for each amino acid, will determine its structure, polarity and pH.
Refer to chart below to explore structures, properties and types for each of the 20 standard amino acids.
Amino Acids ▲ ▼ | Structure ▲ ▼ | Abbr (3) ▲ ▼ | Abbr (1) ▲ ▼ | Enzymes ▲ ▼ | Products ▲ ▼ | Codon ▲ ▼ | Class ▲ ▼ | Hydrophobicity (pH 7) ▲ ▼ | Freq. in Proteins (max. 10) ▲ ▼ | pKa ▲ ▼ | pI ▲ ▼ | Chemical formula ▲ ▼ | Molar mass ▲ ▼ | IUPAC name ▲ ▼ | Other names ▲ ▼ | CAS Number ▲ ▼ | InChI ▲ ▼ | SMILES ▲ ▼ | Appearance ▲ ▼ | Density ▲ ▼ | Melting point ▲ ▼ | Solubility in water ▲ ▼ |
Alanine | Ala | A | Alanine Aminotransferase | 13803, 13802, 13826, 13825 | GCT, GCC, GCA, GCG | Aliphatic | 41 | 7.5 | 2.34 | 6.00 | C3H7NO2 | 89.094 | Alanine | 2-Aminopropanoic acid | 338-69-2; 56-41-7; 302-72-7; | InChI=1S/C2H4NH2COOH/c1-2(4)3(5)6/h2H,4H2,1H3,... | O=C(O)C(N)C | white powder | 1.424 g/cm3 | 258 °C (496 °F; 531 K) (sublimes) | 167.2 g/L (25 °C) | |
Arginine | Arg | R | Arginase | - | CGT, CGC, CGA, CGG, AGA, AGG | Basic | -14 | 5.0 | 2.17 | 10.76 | C6H14N4O2 | 174.204 | (S)-2-Amino-5-guanidinopentanoic acid | 2-Amino-5-guanidinopentanoic acid | 7200-25-1; 157-06-2; 74-79-3 | InChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9... | NC(CCCNC(N)=N)C(O)=O | White crystals | 1.5±0.1 g/cm3 | 260 °C; 500 °F; 533 K | 14.87 g/100 mL (20 °C) | |
Asparagine | Asn | N | Asparagine Synthetase; Asparaginase | - | AAT, AAC | Amidic | -28 | 4.5 | 2.02 | 5.41 | C4H8N2O3 | 132.119 | Asparagine | 2-Amino-3-carbamoylpropanoic acid | 70-47-3 | InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2... | O=C(N)C[C@H](N)C(=O)O | white crystals | 1.543 g/cm3 | 234 °C (453 °F; 507 K) | 2.94 g/100 mL | |
Aspartic acid | Asp | D | Aspartic Protease; Aspartic Proteinase | 13828, 13827, 13480 | GAT, GAC | Acidic | -55 | 5.0 | 1.88 | 2.77 | C4H7NO4 | 133.103 | 2-Aminobutanedioic acid | Aminosuccinic acid; Asparagic acid; Asparagini... | 617-45-8; 56-84-8; 1783-96-6 | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,... | O=C(O)CC(N)C(=O)O | colourless crystals | 1.7 g/cm3 | 270 °C (518 °F; 543 K) | 4.5 g/L | |
Cysteine | Cys | C | Cysteine Protease; Cysteine Peptidase | - | TGT, TGC | Sulfur-containing | 49 | 2.0 | 1.96 | 5.07 | C3H7NO2S | 121.150 | Cysteine | 2-Amino-3-sulfhydrylpropanoic acid | 52-90-4; 52-89-1 | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(... | C([C@@H](C(=O)O)N)S | white crystals or powder | 1.3±0.1 g/cm | 240 °C (464 °F; 513 K) decomposes | soluble | |
Glutamic acid | Glu | E | Glutamic Acid Decarboxylase | 10054, 11302 | GAA, GAG | Acidic | -31 | 6.5 | 2.19 | 3.22 | C5H9NO4 | 147.130 | 2-Aminopentanedioic acid | 2-Aminoglutaric acid | L isomer: 56-86-0; racemate: 617-65-2; D isome... | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2... | l isomer: C(CC(=O)O)[C@@H](C(=O)O)N | white crystalline powder | 1.4601 (20 °C) | 199 °C (390 °F; 472 K) decomposes | 7.5 g/L (20 °C) | |
Glutamine | Gln | Q | Glutamine Synthetase | 11302 | CAA, CAG | Amidic | -10 | 4.0 | 2.17 | 5.65 | C5H10N2O3 | 146.146 | Glutamine | L-Glutamine; (levo)glutamide; 2,5-Diamino-5-ox... | 56-85-9 | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1... | O=C(N)CCC(N)C(=O)O | White crystalline powder | 1.47 g/cm3 (20 °C) | decomposes around 185°C | soluble | |
Glycine | Gly | G | Glycine Decarboxylase Complex; Glycine Hydroxymethyltransferase; Glycine N-Methyltransferase | 395, 396 | GGT, GGC, GGA, GGG | Aliphatic | 0 | 7.0 | 2.34 | 5.97 | C2H5NO2 | 75.067 | 2-aminoacetic acid | 2-Aminoethanoic acid, Glycocoll | 56-40-6 | InChI=1S/C2H5NH2/c3-1-2(4)5/h1,3H2,(H,4,5); Ke... | C(C(=O)O)N | White solid | 1.1607 g/cm3 | 233 °C (451 °F; 506 K) (decomposition) | 24.99 g/100 mL (25 °C) | |
Histidine | His | H | Histidine Ammonia-Lyase; Histidine Decarboxylase; Histidine Acid Phytases | - | CAT, CAC | Basic | 8 | 2.0 | 1.82 | 7.59 | C6H9N3O2 | 155.157 | Histidine | 2-Amino-3-(1H-imidazol-4-yl)propanoic acid | 71-00-1 | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h... | O=C([C@H](CC1=CNC=N1)N)O | colourless crystals | 1.4±0.1 g/cm3 | 287 °C | 4.19g/100g @ 25 °C | |
Isoleucine | Ile | I | L-Isoleucine 4-Hydroxlase; Isoleucine 2-Epimerase | - | ATT, ATC, ATA | Aliphatic | 99 | 5.5 | 2.36 | 6.02 | C6H13NO2 | 131.175 | Isoleucine | (2S,3S)-2-amino-3-methylpentanoic acid | 73-32-5 | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7... | CC[C@H](C)[C@@H](C(=O)O)N | waxy, shiny crystals | ?1.0±0.1 g/cm3 | 285.5 °C | soluble |
References
This online tool may be cited as follows
MLA | "Quest Database™ Amino Acid Reference Chart." AAT Bioquest, Inc., 18 Sep. 2025, https://www.aatbio.com/data-sets/amino-acid-reference-chart-table. | |
APA | AAT Bioquest, Inc. (2025, September 18). Quest Database™ Amino Acid Reference Chart. AAT Bioquest. https://www.aatbio.com/data-sets/amino-acid-reference-chart-table. | |
BibTeX | EndNote | RefMan |