| Type | Zwitterionic |
| Molecular Weight | 336 |
| Molecular Formula | CH3(CH2)11N+(CH3)2CH2CH2CH2SO3- |
| Critical Micelle Concentration (CMC) (?) | 2-4 |
| Solubility | Water soluble |
| Aggregation number | 55 |
| Average micellar weight | 18,500 |
| Applications | Sulfobetaine 3-12 is a detergent used for the solubilization of membrane proteins in their native state. |
| Chemical Structure |
MLA | "Quest Database™ Sulfobetaine 3-12 (SB 3-12) Detergent." AAT Bioquest, Inc., 17 Dec. 2025, https://www.aatbio.com/resources/biological-detergents-properties-and-applications/sulfobetaine-3-12-sb-3-12. | |
APA | AAT Bioquest, Inc. (2025, December 17). Quest Database™ Sulfobetaine 3-12 (SB 3-12) Detergent. AAT Bioquest. https://www.aatbio.com/resources/biological-detergents-properties-and-applications/sulfobetaine-3-12-sb-3-12. | |
| BibTeX | EndNote | RefMan |