| Type | Zwitterionic |
| Molecular Weight | 364 |
| Molecular Formula | CH3(CH2)13N+(CH3)2CH2CH2CH2SO3- |
| Critical Micelle Concentration (CMC) (?) | 0.1-0.4 |
| Solubility | Water soluble |
| Aggregation number | 83 |
| Average micellar weight | 30,200 |
| Applications | Sulfobetaine 3-14 is a detergent used for the solubilization of membrane proteins in their native state. |
| Chemical Structure |
MLA | "Quest Database™ Sulfobetaine 3-14 (SB 3-14) Detergent." AAT Bioquest, Inc., 15 Mar. 2026, https://www.aatbio.com/resources/biological-detergents-properties-and-applications/sulfobetaine-3-14-sb-3-14. | |
APA | AAT Bioquest, Inc. (2026, March 15). Quest Database™ Sulfobetaine 3-14 (SB 3-14) Detergent. AAT Bioquest. https://www.aatbio.com/resources/biological-detergents-properties-and-applications/sulfobetaine-3-14-sb-3-14. | |
| BibTeX | EndNote | RefMan |