| Type | Zwitterionic | 
| Molecular Weight | 364 | 
| Molecular Formula | CH3(CH2)13N+(CH3)2CH2CH2CH2SO3- | 
| Critical Micelle Concentration (CMC) (?) | 0.1-0.4 | 
| Solubility | Water soluble | 
| Aggregation number | 83 | 
| Average micellar weight | 30,200 | 
| Applications | Sulfobetaine 3-14 is a detergent used for the solubilization of membrane proteins in their native state. | 
| Chemical Structure | 
MLA  | "Quest Database™ Sulfobetaine 3-14 (SB 3-14) Detergent." AAT Bioquest, Inc., 4 Nov. 2025, https://www.aatbio.com/resources/biological-detergents-properties-and-applications/sulfobetaine-3-14-sb-3-14. | |
APA  | AAT Bioquest, Inc. (2025, November 4). Quest Database™ Sulfobetaine 3-14 (SB 3-14) Detergent. AAT Bioquest. https://www.aatbio.com/resources/biological-detergents-properties-and-applications/sulfobetaine-3-14-sb-3-14. | |
| BibTeX | EndNote | RefMan |